C15H23N5O3 — CID 136649187
tert-butyl N-[3-[(1-oxido-2,4-dihydro-1H-1,2,4-benzotriazin-1-ium-3-ylidene)amino]propyl]carbamate (PubChem CID 136649187) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is tert-butyl N-[3-[(1-oxido-2,4-dihydro-1H-1,2,4-benzotriazin-1-ium-3-ylidene)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(1-oxido-2,4-dihydro-1H-1,2,4-benzotriazin-1-ium-3-ylidene)amino]propyl]carbamate |
|---|---|
| PubChem CID | 136649187 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | tert-butyl N-[3-[(1-oxido-2,4-dihydro-1H-1,2,4-benzotriazin-1-ium-3-ylidene)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC/N=C1\Nc2ccccc2[NH+]([O-])N1 |
| InChI | InChI=1S/C15H23N5O3/c1-15(2,3)23-14(21)17-10-6-9-16-13-18-11-7-4-5-8-12(11)20(22)19-13/h4-5,7-8,20H,6,9-10H2,1-3H3,(H,17,21)(H2,16,18,19) |
| InChIKey | QHMDCTAROQWNNC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|