About 1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one
1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 136649491) has the molecular formula C14H22N4O
and a molecular weight of 262.36 g/mol. Its IUPAC name is 1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 136649491 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCCCCCCCCn1ncc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C14H22N4O/c1-2-3-4-5-6-7-8-9-18-13-12(10-17-18)14(19)16-11-15-13/h10-11H,2-9H2,1H3,(H,15,16,19) |
| InChIKey | XQMJUUIKSABWEB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CID 136649491) is 1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one is CCCCCCCCCn1ncc2c(=O)[nH]cnc21.
What is the InChIKey of 1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is XQMJUUIKSABWEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O/c1-2-3-4-5-6-7-8-9-18-13-12(10-17-18)14(19)16-11-15-13/h10-11H,2-9H2,1H3,(H,15,16,19).
What are the key properties of 1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 262.36 g/mol, XLogP of 2.87, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nonyl-5H-pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 136649491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).