C20H19N5O2 — CID 136649644
2-(2,3-dihydro-1H-inden-1-ylimino)-N-(5-methyl-1,3,4-oxadiazol-2-yl)-1,4-dihydro-3,1-benzoxazin-6-amine (PubChem CID 136649644) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-ylimino)-N-(5-methyl-1,3,4-oxadiazol-2-yl)-1,4-dihydro-3,1-benzoxazin-6-amine.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-ylimino)-N-(5-methyl-1,3,4-oxadiazol-2-yl)-1,4-dihydro-3,1-benzoxazin-6-amine |
|---|---|
| PubChem CID | 136649644 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-ylimino)-N-(5-methyl-1,3,4-oxadiazol-2-yl)-1,4-dihydro-3,1-benzoxazin-6-amine |
| SMILES | Cc1nnc(Nc2ccc3c(c2)CO/C(=N\C2CCc4ccccc42)N3)o1 |
| InChI | InChI=1S/C20H19N5O2/c1-12-24-25-20(27-12)21-15-7-9-17-14(10-15)11-26-19(22-17)23-18-8-6-13-4-2-3-5-16(13)18/h2-5,7,9-10,18H,6,8,11H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | DJWCOCOWTXPJGW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|