C20H20N2O3 — CID 136649708
1-(4,6-dihydroxy-8,8-dimethyl-7,16-diazapentacyclo[9.6.1.02,9.03,7.015,18]octadeca-1(17),3,5,11(18),12,14-hexaen-5-yl)ethanone (PubChem CID 136649708) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-(4,6-dihydroxy-8,8-dimethyl-7,16-diazapentacyclo[9.6.1.02,9.03,7.015,18]octadeca-1(17),3,5,11(18),12,14-hexaen-5-yl)ethanone.
| Compound Name | 1-(4,6-dihydroxy-8,8-dimethyl-7,16-diazapentacyclo[9.6.1.02,9.03,7.015,18]octadeca-1(17),3,5,11(18),12,14-hexaen-5-yl)ethanone |
|---|---|
| PubChem CID | 136649708 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-(4,6-dihydroxy-8,8-dimethyl-7,16-diazapentacyclo[9.6.1.02,9.03,7.015,18]octadeca-1(17),3,5,11(18),12,14-hexaen-5-yl)ethanone |
| SMILES | CC(=O)c1c(O)c2n(c1O)C(C)(C)C1Cc3cccc4[nH]cc(c34)C21 |
| InChI | InChI=1S/C20H20N2O3/c1-9(23)14-18(24)17-16-11-8-21-13-6-4-5-10(15(11)13)7-12(16)20(2,3)22(17)19(14)25/h4-6,8,12,16,21,24-25H,7H2,1-3H3 |
| InChIKey | QMBUCWVILCOIEG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |