C25H25N5O16 — CID 136650855
6-[4-(2,2,3,3,4,4-hexahydroxy-6-oxopiperidin-1-yl)-2,3,5,6-tetrahydroxyphenyl]-4,4-dihydroxy-1-(4-methoxyphenyl)-7-oxo-5H-pyrazolo[5,4-c]pyridine-3-carboxamide (PubChem CID 136650855) has the molecular formula C25H25N5O16 and a molecular weight of 651.49 g/mol. Its IUPAC name is 6-[4-(2,2,3,3,4,4-hexahydroxy-6-oxopiperidin-1-yl)-2,3,5,6-tetrahydroxyphenyl]-4,4-dihydroxy-1-(4-methoxyphenyl)-7-oxo-5H-pyrazolo[5,4-c]pyridine-3-carboxamide.
| Compound Name | 6-[4-(2,2,3,3,4,4-hexahydroxy-6-oxopiperidin-1-yl)-2,3,5,6-tetrahydroxyphenyl]-4,4-dihydroxy-1-(4-methoxyphenyl)-7-oxo-5H-pyrazolo[5,4-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 136650855 |
| Molecular Formula | C25H25N5O16 |
| Molecular Weight | 651.49 g/mol |
| Exact Mass | 651.13 |
| IUPAC Name | 6-[4-(2,2,3,3,4,4-hexahydroxy-6-oxopiperidin-1-yl)-2,3,5,6-tetrahydroxyphenyl]-4,4-dihydroxy-1-(4-methoxyphenyl)-7-oxo-5H-pyrazolo[5,4-c]pyridine-3-carboxamide |
| SMILES | COc1ccc(-n2nc(C(N)=O)c3c2C(=O)N(c2c(O)c(O)c(N4C(=O)CC(O)(O)C(O)(O)C4(O)O)c(O)c2O)CC3(O)O)cc1 |
| InChI | InChI=1S/C25H25N5O16/c1-46-9-4-2-8(3-5-9)30-13-11(12(27-30)20(26)36)22(38,39)7-28(21(13)37)14-16(32)18(34)15(19(35)17(14)33)29-10(31)6-23(40,41)24(42,43)25(29,44)45/h2-5,32-35,38-45H,6-7H2,1H3,(H2,26,36) |
| InChIKey | LIVPEJLRLWHCFC-UHFFFAOYSA-N |
| XLogP | -4.66 |
| TPSA | 353.52 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.49 |
| LogP ≤ 5 | -4.66 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|