C27H31FN4O — CID 136650944
1-[1-[2-[[(3aR,9bS)-7-fluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]ethyl]piperidin-4-yl]-3H-indol-2-one (PubChem CID 136650944) has the molecular formula C27H31FN4O and a molecular weight of 446.57 g/mol. Its IUPAC name is 1-[1-[2-[[(3aR,9bS)-7-fluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]ethyl]piperidin-4-yl]-3H-indol-2-one.
| Compound Name | 1-[1-[2-[[(3aR,9bS)-7-fluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]ethyl]piperidin-4-yl]-3H-indol-2-one |
|---|---|
| PubChem CID | 136650944 |
| Molecular Formula | C27H31FN4O |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 1-[1-[2-[[(3aR,9bS)-7-fluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]ethyl]piperidin-4-yl]-3H-indol-2-one |
| SMILES | O=C1Cc2ccccc2N1C1CCN(CC/N=C2\C[C@H]3c4ccc(F)cc4CC[C@H]3N2)CC1 |
| InChI | InChI=1S/C27H31FN4O/c28-20-6-7-22-18(15-20)5-8-24-23(22)17-26(30-24)29-11-14-31-12-9-21(10-13-31)32-25-4-2-1-3-19(25)16-27(32)33/h1-4,6-7,15,21,23-24H,5,8-14,16-17H2,(H,29,30)/t23-,24+/m0/s1 |
| InChIKey | IFBQBAWWHXXAFI-BJKOFHAPSA-N |
| XLogP | 3.67 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|