C23H43N5O6Si2 — CID 136651018
9-[(6aR,8R,9aR)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-methylimino-4,5-dihydro-3H-purin-6-one (PubChem CID 136651018) has the molecular formula C23H43N5O6Si2 and a molecular weight of 541.80 g/mol. Its IUPAC name is 9-[(6aR,8R,9aR)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-methylimino-4,5-dihydro-3H-purin-6-one.
| Compound Name | 9-[(6aR,8R,9aR)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-methylimino-4,5-dihydro-3H-purin-6-one |
|---|---|
| PubChem CID | 136651018 |
| Molecular Formula | C23H43N5O6Si2 |
| Molecular Weight | 541.80 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | 9-[(6aR,8R,9aR)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-methylimino-4,5-dihydro-3H-purin-6-one |
| SMILES | C/N=C1\NC(=O)C2N=CN([C@@H]3O[C@@H]4CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@@H]4C3O)C2N1 |
| InChI | InChI=1S/C23H43N5O6Si2/c1-12(2)35(13(3)4)31-10-16-19(33-36(34-35,14(5)6)15(7)8)18(29)22(32-16)28-11-25-17-20(28)26-23(24-9)27-21(17)30/h11-20,22,29H,10H2,1-9H3,(H2,24,26,27,30)/t16-,17?,18?,19+,20?,22-/m1/s1 |
| InChIKey | CCXYWSSGHDEPSB-OHTACBCBSA-N |
| XLogP | 1.77 |
| TPSA | 126.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.80 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|