C14H18ClN3O — CID 136651135
2-[2-(6-chloro-1,4-dimethyl-2H-pyridin-5-yl)ethyl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 136651135) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 2-[2-(6-chloro-1,4-dimethyl-2H-pyridin-5-yl)ethyl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(6-chloro-1,4-dimethyl-2H-pyridin-5-yl)ethyl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136651135 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-[2-(6-chloro-1,4-dimethyl-2H-pyridin-5-yl)ethyl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | CC1=CCN(C)C(Cl)=C1CCc1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C14H18ClN3O/c1-9-6-7-18(3)14(15)11(9)4-5-12-16-10(2)8-13(19)17-12/h6,8H,4-5,7H2,1-3H3,(H,16,17,19) |
| InChIKey | RAYZCMVGVUXYHZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|