C23H31N5O5S — CID 136652599
7-cyclopentyl-2-[2-ethoxy-5-[ethyl-(2-hydroxyethyl)-sulfinatoazaniumyl]phenyl]-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazine (PubChem CID 136652599) has the molecular formula C23H31N5O5S and a molecular weight of 489.60 g/mol. Its IUPAC name is 7-cyclopentyl-2-[2-ethoxy-5-[ethyl-(2-hydroxyethyl)-sulfinatoazaniumyl]phenyl]-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazine.
| Compound Name | 7-cyclopentyl-2-[2-ethoxy-5-[ethyl-(2-hydroxyethyl)-sulfinatoazaniumyl]phenyl]-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 136652599 |
| Molecular Formula | C23H31N5O5S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 7-cyclopentyl-2-[2-ethoxy-5-[ethyl-(2-hydroxyethyl)-sulfinatoazaniumyl]phenyl]-5-methyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazine |
| SMILES | CCOc1ccc([N+](CC)(CCO)S(=O)[O-])cc1-c1nn2c(C3CCCC3)nc(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C23H31N5O5S/c1-4-28(12-13-29,34(31)32)17-10-11-19(33-5-2)18(14-17)21-25-23(30)20-15(3)24-22(27(20)26-21)16-8-6-7-9-16/h10-11,14,16,29H,4-9,12-13H2,1-3H3,(H-,25,26,30,31,32) |
| InChIKey | BVFADWLXWLAYDM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|