C27H33FN4O — CID 136652638
(5R,7S)-8-benzyl-4-cyclohexylimino-1-(3-fluorophenyl)-7-methyl-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 136652638) has the molecular formula C27H33FN4O and a molecular weight of 448.59 g/mol. Its IUPAC name is (5R,7S)-8-benzyl-4-cyclohexylimino-1-(3-fluorophenyl)-7-methyl-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | (5R,7S)-8-benzyl-4-cyclohexylimino-1-(3-fluorophenyl)-7-methyl-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 136652638 |
| Molecular Formula | C27H33FN4O |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (5R,7S)-8-benzyl-4-cyclohexylimino-1-(3-fluorophenyl)-7-methyl-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | C[C@H]1C[C@]2(CCN1Cc1ccccc1)/C(=N/C1CCCCC1)NC(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C27H33FN4O/c1-20-18-27(15-16-31(20)19-21-9-4-2-5-10-21)25(29-23-12-6-3-7-13-23)30-26(33)32(27)24-14-8-11-22(28)17-24/h2,4-5,8-11,14,17,20,23H,3,6-7,12-13,15-16,18-19H2,1H3,(H,29,30,33)/t20-,27+/m0/s1 |
| InChIKey | YNODVOARUZZRMG-CCLHPLFOSA-N |
| XLogP | 5.51 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|