C11H13NO3 — CID 136652954
2-(5-ethyl-4,5-dihydro-1,2-oxazol-3-yl)benzene-1,4-diol (PubChem CID 136652954) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-(5-ethyl-4,5-dihydro-1,2-oxazol-3-yl)benzene-1,4-diol.
| Compound Name | 2-(5-ethyl-4,5-dihydro-1,2-oxazol-3-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 136652954 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-(5-ethyl-4,5-dihydro-1,2-oxazol-3-yl)benzene-1,4-diol |
| SMILES | CCC1CC(c2cc(O)ccc2O)=NO1 |
| InChI | InChI=1S/C11H13NO3/c1-2-8-6-10(12-15-8)9-5-7(13)3-4-11(9)14/h3-5,8,13-14H,2,6H2,1H3 |
| InChIKey | XLZZJPPQQHCEFC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|