C29H21FN6O4 — CID 136653040
1-[(4-aminophenyl)diazenyl]-N-[3-(dihydroxyamino)phenyl]-8-fluoro-2-hydroxy-11H-benzo[a]carbazole-3-carboxamide (PubChem CID 136653040) has the molecular formula C29H21FN6O4 and a molecular weight of 536.52 g/mol. Its IUPAC name is 1-[(4-aminophenyl)diazenyl]-N-[3-(dihydroxyamino)phenyl]-8-fluoro-2-hydroxy-11H-benzo[a]carbazole-3-carboxamide.
| Compound Name | 1-[(4-aminophenyl)diazenyl]-N-[3-(dihydroxyamino)phenyl]-8-fluoro-2-hydroxy-11H-benzo[a]carbazole-3-carboxamide |
|---|---|
| PubChem CID | 136653040 |
| Molecular Formula | C29H21FN6O4 |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 1-[(4-aminophenyl)diazenyl]-N-[3-(dihydroxyamino)phenyl]-8-fluoro-2-hydroxy-11H-benzo[a]carbazole-3-carboxamide |
| SMILES | Nc1ccc(/N=N/c2c(O)c(C(=O)Nc3cccc(N(O)O)c3)cc3ccc4c5cc(F)ccc5[nH]c4c23)cc1 |
| InChI | InChI=1S/C29H21FN6O4/c30-16-5-11-24-22(13-16)21-10-4-15-12-23(29(38)32-19-2-1-3-20(14-19)36(39)40)28(37)27(25(15)26(21)33-24)35-34-18-8-6-17(31)7-9-18/h1-14,33,37,39-40H,31H2,(H,32,38)/b35-34+ |
| InChIKey | VFXIXEBNCFUWSB-XAHDOWKMSA-N |
| XLogP | 7.15 |
| TPSA | 159.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|