C21H40N8O4 — CID 136653134
(2-amino-10,10-dihydroxy-6-pentylimino-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-4-yl)methyl N-(6-aminohexyl)carbamate (PubChem CID 136653134) has the molecular formula C21H40N8O4 and a molecular weight of 468.60 g/mol. Its IUPAC name is (2-amino-10,10-dihydroxy-6-pentylimino-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-4-yl)methyl N-(6-aminohexyl)carbamate.
| Compound Name | (2-amino-10,10-dihydroxy-6-pentylimino-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-4-yl)methyl N-(6-aminohexyl)carbamate |
|---|---|
| PubChem CID | 136653134 |
| Molecular Formula | C21H40N8O4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (2-amino-10,10-dihydroxy-6-pentylimino-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-4-yl)methyl N-(6-aminohexyl)carbamate |
| SMILES | CCCCC/N=C1\NC(COC(=O)NCCCCCCN)C2N=C(N)NC23N1CCC3(O)O |
| InChI | InChI=1S/C21H40N8O4/c1-2-3-7-11-24-18-26-15(14-33-19(30)25-12-8-5-4-6-10-22)16-21(28-17(23)27-16)20(31,32)9-13-29(18)21/h15-16,31-32H,2-14,22H2,1H3,(H,24,26)(H,25,30)(H3,23,27,28) |
| InChIKey | KDFCGPDLRIHLBU-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 182.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|