C29H39N5O2 — CID 136653296
3-[3-[7-(4-tert-butylcyclohexyl)-5-ethyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl]phenyl]-N-propylprop-2-enamide (PubChem CID 136653296) has the molecular formula C29H39N5O2 and a molecular weight of 489.66 g/mol. Its IUPAC name is 3-[3-[7-(4-tert-butylcyclohexyl)-5-ethyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl]phenyl]-N-propylprop-2-enamide.
| Compound Name | 3-[3-[7-(4-tert-butylcyclohexyl)-5-ethyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl]phenyl]-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 136653296 |
| Molecular Formula | C29H39N5O2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | 3-[3-[7-(4-tert-butylcyclohexyl)-5-ethyl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl]phenyl]-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)C=Cc1cccc(-c2nn3c(C4CCC(C(C)(C)C)CC4)nc(CC)c3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C29H39N5O2/c1-6-17-30-24(35)16-11-19-9-8-10-21(18-19)26-32-28(36)25-23(7-2)31-27(34(25)33-26)20-12-14-22(15-13-20)29(3,4)5/h8-11,16,18,20,22H,6-7,12-15,17H2,1-5H3,(H,30,35)(H,32,33,36) |
| InChIKey | AAKLCWYDNUWIKF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|