About 4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol
4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol (PubChem CID 136653710) has the molecular formula C19H18N2O2
and a molecular weight of 306.37 g/mol. Its IUPAC name is 4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol.
Molecular Properties
| Compound Name | 4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol |
| PubChem CID | 136653710 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol |
| SMILES | COc1cc(/N=N/c2cc(C)cc(C)c2)c2ccccc2c1O |
| InChI | InChI=1S/C19H18N2O2/c1-12-8-13(2)10-14(9-12)20-21-17-11-18(23-3)19(22)16-7-5-4-6-15(16)17/h4-11,22H,1-3H3/b21-20+ |
| InChIKey | YVJDKNRUDRASIU-QZQOTICOSA-N |
| XLogP | 5.59 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol?
The IUPAC name of 4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol (CID 136653710) is 4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol.
What is the SMILES notation for 4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol?
The canonical SMILES for 4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol is COc1cc(/N=N/c2cc(C)cc(C)c2)c2ccccc2c1O.
What is the InChIKey of 4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol?
The InChIKey is YVJDKNRUDRASIU-QZQOTICOSA-N. The full InChI is InChI=1S/C19H18N2O2/c1-12-8-13(2)10-14(9-12)20-21-17-11-18(23-3)19(22)16-7-5-4-6-15(16)17/h4-11,22H,1-3H3/b21-20+.
What are the key properties of 4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol?
4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol has a molecular weight of 306.37 g/mol, XLogP of 5.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dimethylphenyl)diazenyl]-2-methoxynaphthalen-1-ol is sourced from PubChem (CID 136653710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).