C8H12Cl3N4O3P — CID 136653763
N-[1-(3-methyl-5-oxo-4H-1,2,4-triazin-6-yl)ethyl]acetamide;phosphoryl trichloride (PubChem CID 136653763) has the molecular formula C8H12Cl3N4O3P and a molecular weight of 349.54 g/mol. Its IUPAC name is N-[1-(3-methyl-5-oxo-4H-1,2,4-triazin-6-yl)ethyl]acetamide;phosphoryl trichloride.
| Compound Name | N-[1-(3-methyl-5-oxo-4H-1,2,4-triazin-6-yl)ethyl]acetamide;phosphoryl trichloride |
|---|---|
| PubChem CID | 136653763 |
| Molecular Formula | C8H12Cl3N4O3P |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | N-[1-(3-methyl-5-oxo-4H-1,2,4-triazin-6-yl)ethyl]acetamide;phosphoryl trichloride |
| SMILES | CC(=O)NC(C)c1nnc(C)[nH]c1=O.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H12N4O2.Cl3OP/c1-4(9-6(3)13)7-8(14)10-5(2)11-12-7;1-5(2,3)4/h4H,1-3H3,(H,9,13)(H,10,11,14); |
| InChIKey | HYUOYIVONGTOQO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|