About ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one
ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one (PubChem CID 136653935) has the molecular formula C12H15IN2O
and a molecular weight of 330.17 g/mol. Its IUPAC name is ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one |
| PubChem CID | 136653935 |
| Molecular Formula | C12H15IN2O |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one |
| SMILES | CC.Cc1nc2c(I)c(C)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C10H9IN2O.C2H6/c1-5-3-4-7-9(8(5)11)12-6(2)13-10(7)14;1-2/h3-4H,1-2H3,(H,12,13,14);1-2H3 |
| InChIKey | STQTXCIVOVRWJN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one?
The IUPAC name of ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one (CID 136653935) is ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one.
What is the SMILES notation for ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one?
The canonical SMILES for ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one is CC.Cc1nc2c(I)c(C)ccc2c(=O)[nH]1.
What is the InChIKey of ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one?
The InChIKey is STQTXCIVOVRWJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IN2O.C2H6/c1-5-3-4-7-9(8(5)11)12-6(2)13-10(7)14;1-2/h3-4H,1-2H3,(H,12,13,14);1-2H3.
What are the key properties of ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one?
ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one has a molecular weight of 330.17 g/mol, XLogP of 3.17, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;8-iodo-2,7-dimethyl-3H-quinazolin-4-one is sourced from PubChem (CID 136653935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).