C25H23ClN7O5S- — CID 136654632
4-chloro-2-[2-(N'-hydroxycarbamimidoyl)-4-pyridinyl]-5-(2-methoxyphenoxy)-6-[(5-propan-2-yl-2-pyridinyl)-sulfinatoamino]pyrimidine (PubChem CID 136654632) has the molecular formula C25H23ClN7O5S- and a molecular weight of 569.02 g/mol. Its IUPAC name is 4-chloro-2-[2-(N'-hydroxycarbamimidoyl)-4-pyridinyl]-5-(2-methoxyphenoxy)-6-[(5-propan-2-yl-2-pyridinyl)-sulfinatoamino]pyrimidine.
| Compound Name | 4-chloro-2-[2-(N'-hydroxycarbamimidoyl)-4-pyridinyl]-5-(2-methoxyphenoxy)-6-[(5-propan-2-yl-2-pyridinyl)-sulfinatoamino]pyrimidine |
|---|---|
| PubChem CID | 136654632 |
| Molecular Formula | C25H23ClN7O5S- |
| Molecular Weight | 569.02 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | 4-chloro-2-[2-(N'-hydroxycarbamimidoyl)-4-pyridinyl]-5-(2-methoxyphenoxy)-6-[(5-propan-2-yl-2-pyridinyl)-sulfinatoamino]pyrimidine |
| SMILES | COc1ccccc1Oc1c(Cl)nc(-c2ccnc(C(N)=NO)c2)nc1N(c1ccc(C(C)C)cn1)S(=O)[O-] |
| InChI | InChI=1S/C25H24ClN7O5S/c1-14(2)16-8-9-20(29-13-16)33(39(35)36)25-21(38-19-7-5-4-6-18(19)37-3)22(26)30-24(31-25)15-10-11-28-17(12-15)23(27)32-34/h4-14,34H,1-3H3,(H2,27,32)(H,35,36)/p-1 |
| InChIKey | YLIXAXBBUTXINY-UHFFFAOYSA-M |
| XLogP | 4.54 |
| TPSA | 172.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.02 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|