C14H13N3O2 — CID 136655090
4-(2-methyl-2,3-dihydroindole-1-carbonyl)-1H-pyrimidin-6-one (PubChem CID 136655090) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 4-(2-methyl-2,3-dihydroindole-1-carbonyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(2-methyl-2,3-dihydroindole-1-carbonyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136655090 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-(2-methyl-2,3-dihydroindole-1-carbonyl)-1H-pyrimidin-6-one |
| SMILES | CC1Cc2ccccc2N1C(=O)c1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C14H13N3O2/c1-9-6-10-4-2-3-5-12(10)17(9)14(19)11-7-13(18)16-8-15-11/h2-5,7-9H,6H2,1H3,(H,15,16,18) |
| InChIKey | WSZUFLCKGVCBCH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |