About 2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid
2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid (PubChem CID 136655699) has the molecular formula C20H26N2O3
and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid.
Molecular Properties
| Compound Name | 2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid |
| PubChem CID | 136655699 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid |
| SMILES | CCC(C)C(=O)O.CCc1cc(/N=N/c2ccc(C)cc2)ccc1O |
| InChI | InChI=1S/C15H16N2O.C5H10O2/c1-3-12-10-14(8-9-15(12)18)17-16-13-6-4-11(2)5-7-13;1-3-4(2)5(6)7/h4-10,18H,3H2,1-2H3;4H,3H2,1-2H3,(H,6,7)/b17-16+; |
| InChIKey | BHCQTPOXMXCYBF-CMBBICFISA-N |
| XLogP | 5.80 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid?
The IUPAC name of 2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid (CID 136655699) is 2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid.
What is the SMILES notation for 2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid?
The canonical SMILES for 2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid is CCC(C)C(=O)O.CCc1cc(/N=N/c2ccc(C)cc2)ccc1O.
What is the InChIKey of 2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid?
The InChIKey is BHCQTPOXMXCYBF-CMBBICFISA-N. The full InChI is InChI=1S/C15H16N2O.C5H10O2/c1-3-12-10-14(8-9-15(12)18)17-16-13-6-4-11(2)5-7-13;1-3-4(2)5(6)7/h4-10,18H,3H2,1-2H3;4H,3H2,1-2H3,(H,6,7)/b17-16+;.
What are the key properties of 2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid?
2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid has a molecular weight of 342.44 g/mol, XLogP of 5.80, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-[(4-methylphenyl)diazenyl]phenol;2-methylbutanoic acid is sourced from PubChem (CID 136655699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).