About 5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine
5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine (PubChem CID 136655966) has the molecular formula C6H10FN3
and a molecular weight of 143.16 g/mol. Its IUPAC name is 5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine.
Molecular Properties
| Compound Name | 5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine |
| PubChem CID | 136655966 |
| Molecular Formula | C6H10FN3 |
| Molecular Weight | 143.16 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine |
| SMILES | C/N=C1\NC=C(F)C(C)N1 |
| InChI | InChI=1S/C6H10FN3/c1-4-5(7)3-9-6(8-2)10-4/h3-4H,1-2H3,(H2,8,9,10) |
| InChIKey | BVYOIIOSIXQLBS-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine?
The IUPAC name of 5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine (CID 136655966) is 5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine.
What is the SMILES notation for 5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine?
The canonical SMILES for 5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine is C/N=C1\NC=C(F)C(C)N1.
What is the InChIKey of 5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine?
The InChIKey is BVYOIIOSIXQLBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10FN3/c1-4-5(7)3-9-6(8-2)10-4/h3-4H,1-2H3,(H2,8,9,10).
What are the key properties of 5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine?
5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine has a molecular weight of 143.16 g/mol, XLogP of 0.36, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N,4-dimethyl-3,4-dihydro-1H-pyrimidin-2-imine is sourced from PubChem (CID 136655966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).