C15H22N2O4P+ — CID 136656120
[[2-(2-aminoethyl)phenoxy]-(1-cyclobutyloxy-1-oxopropan-2-yl)amino]-oxophosphanium (PubChem CID 136656120) has the molecular formula C15H22N2O4P+ and a molecular weight of 325.33 g/mol. Its IUPAC name is [[2-(2-aminoethyl)phenoxy]-(1-cyclobutyloxy-1-oxopropan-2-yl)amino]-oxophosphanium.
| Compound Name | [[2-(2-aminoethyl)phenoxy]-(1-cyclobutyloxy-1-oxopropan-2-yl)amino]-oxophosphanium |
|---|---|
| PubChem CID | 136656120 |
| Molecular Formula | C15H22N2O4P+ |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [[2-(2-aminoethyl)phenoxy]-(1-cyclobutyloxy-1-oxopropan-2-yl)amino]-oxophosphanium |
| SMILES | CC(C(=O)OC1CCC1)N(Oc1ccccc1CCN)[PH+]=O |
| InChI | InChI=1S/C15H21N2O4P/c1-11(15(18)20-13-6-4-7-13)17(22-19)21-14-8-3-2-5-12(14)9-10-16/h2-3,5,8,11,13H,4,6-7,9-10,16H2,1H3/p+1 |
| InChIKey | RADZFDIAZQMHNS-UHFFFAOYSA-O |
| XLogP | 2.21 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|