C28H33F4N7O7 — CID 136656195
acetic acid;2-[6-[3-amino-5-(trifluoromethyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]-N-[(4-carbamimidoyl-2-fluoro-5-hydroxyphenyl)methyl]acetamide (PubChem CID 136656195) has the molecular formula C28H33F4N7O7 and a molecular weight of 655.61 g/mol. Its IUPAC name is acetic acid;2-[6-[3-amino-5-(trifluoromethyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]-N-[(4-carbamimidoyl-2-fluoro-5-hydroxyphenyl)methyl]acetamide.
| Compound Name | acetic acid;2-[6-[3-amino-5-(trifluoromethyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]-N-[(4-carbamimidoyl-2-fluoro-5-hydroxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 136656195 |
| Molecular Formula | C28H33F4N7O7 |
| Molecular Weight | 655.61 g/mol |
| Exact Mass | 655.24 |
| IUPAC Name | acetic acid;2-[6-[3-amino-5-(trifluoromethyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]-N-[(4-carbamimidoyl-2-fluoro-5-hydroxyphenyl)methyl]acetamide |
| SMILES | CC(=O)O.CC(=O)O.[H]/N=C(\N)c1cc(F)c(CNC(=O)Cn2c(-c3cc(N)cc(C(F)(F)F)c3)cnc(NC(C)C)c2=O)cc1O |
| InChI | InChI=1S/C24H25F4N7O3.2C2H4O2/c1-11(2)34-22-23(38)35(18(9-33-22)12-3-14(24(26,27)28)6-15(29)4-12)10-20(37)32-8-13-5-19(36)16(21(30)31)7-17(13)25;2*1-2(3)4/h3-7,9,11,36H,8,10,29H2,1-2H3,(H3,30,31)(H,32,37)(H,33,34);2*1H3,(H,3,4) |
| InChIKey | QPRJKHKAPQQVNH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 246.74 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|