C17H14ClN5O4S — CID 136656438
5-[[1-(4-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylidene]-6-imino-1,3-dimethyl-1,3-diazinane-2,4-dione (PubChem CID 136656438) has the molecular formula C17H14ClN5O4S and a molecular weight of 419.85 g/mol. Its IUPAC name is 5-[[1-(4-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylidene]-6-imino-1,3-dimethyl-1,3-diazinane-2,4-dione.
| Compound Name | 5-[[1-(4-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylidene]-6-imino-1,3-dimethyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 136656438 |
| Molecular Formula | C17H14ClN5O4S |
| Molecular Weight | 419.85 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 5-[[1-(4-chlorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylidene]-6-imino-1,3-dimethyl-1,3-diazinane-2,4-dione |
| SMILES | [H]/N=C1/C(=Cc2c(O)n(-c3ccc(Cl)cc3)c(=S)[nH]c2=O)C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C17H14ClN5O4S/c1-21-12(19)10(14(25)22(2)17(21)27)7-11-13(24)20-16(28)23(15(11)26)9-5-3-8(18)4-6-9/h3-7,19,26H,1-2H3,(H,20,24,28)/b10-7?,19-12- |
| InChIKey | CDVDWJTVNRDALV-KNRHDFNYSA-N |
| XLogP | 2.14 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.85 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|