C23H19N3O3S — CID 136656826
6-hydroxy-5-[(4-phenylmethoxyindol-3-ylidene)methyl]-1-prop-2-enyl-2-sulfanylidenepyrimidin-4-one (PubChem CID 136656826) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is 6-hydroxy-5-[(4-phenylmethoxyindol-3-ylidene)methyl]-1-prop-2-enyl-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 6-hydroxy-5-[(4-phenylmethoxyindol-3-ylidene)methyl]-1-prop-2-enyl-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 136656826 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 6-hydroxy-5-[(4-phenylmethoxyindol-3-ylidene)methyl]-1-prop-2-enyl-2-sulfanylidenepyrimidin-4-one |
| SMILES | C=CCn1c(O)c(C=C2C=Nc3cccc(OCc4ccccc4)c32)c(=O)[nH]c1=S |
| InChI | InChI=1S/C23H19N3O3S/c1-2-11-26-22(28)17(21(27)25-23(26)30)12-16-13-24-18-9-6-10-19(20(16)18)29-14-15-7-4-3-5-8-15/h2-10,12-13,28H,1,11,14H2,(H,25,27,30) |
| InChIKey | SNNODEUKOHYUDO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|