C24H26ClN7OS — CID 136657292
3-[[(6-chloro-3-pyridinyl)methylamino]-(4-hydroxyanilino)methylidene]-4-imino-1-methyl-5a,6,7,8,9,9a-hexahydropyrimido[1,2-a]benzimidazole-2-thione (PubChem CID 136657292) has the molecular formula C24H26ClN7OS and a molecular weight of 496.04 g/mol. Its IUPAC name is 3-[[(6-chloro-3-pyridinyl)methylamino]-(4-hydroxyanilino)methylidene]-4-imino-1-methyl-5a,6,7,8,9,9a-hexahydropyrimido[1,2-a]benzimidazole-2-thione.
| Compound Name | 3-[[(6-chloro-3-pyridinyl)methylamino]-(4-hydroxyanilino)methylidene]-4-imino-1-methyl-5a,6,7,8,9,9a-hexahydropyrimido[1,2-a]benzimidazole-2-thione |
|---|---|
| PubChem CID | 136657292 |
| Molecular Formula | C24H26ClN7OS |
| Molecular Weight | 496.04 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 3-[[(6-chloro-3-pyridinyl)methylamino]-(4-hydroxyanilino)methylidene]-4-imino-1-methyl-5a,6,7,8,9,9a-hexahydropyrimido[1,2-a]benzimidazole-2-thione |
| SMILES | [H]/N=c1/c(=C(NCc2ccc(Cl)nc2)Nc2ccc(O)cc2)c(=S)n(C)c2n1C1CCCCC1N=2 |
| InChI | InChI=1S/C24H26ClN7OS/c1-31-23(34)20(21(26)32-18-5-3-2-4-17(18)30-24(31)32)22(29-15-7-9-16(33)10-8-15)28-13-14-6-11-19(25)27-12-14/h6-12,17-18,26,28-29,33H,2-5,13H2,1H3/b22-20?,26-21- |
| InChIKey | NMXPKGMPBOQTLT-MGIPTRCJSA-N |
| XLogP | 2.87 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.04 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|