C15H18N2O9 — CID 136657996
(2,5-dihydroxypyrrol-1-yl) 3,4-dihydroxy-2-oxo-4-(2-oxo-5-propan-2-ylidenepyrrolidin-1-yl)oxybutanoate (PubChem CID 136657996) has the molecular formula C15H18N2O9 and a molecular weight of 370.31 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3,4-dihydroxy-2-oxo-4-(2-oxo-5-propan-2-ylidenepyrrolidin-1-yl)oxybutanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3,4-dihydroxy-2-oxo-4-(2-oxo-5-propan-2-ylidenepyrrolidin-1-yl)oxybutanoate |
|---|---|
| PubChem CID | 136657996 |
| Molecular Formula | C15H18N2O9 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3,4-dihydroxy-2-oxo-4-(2-oxo-5-propan-2-ylidenepyrrolidin-1-yl)oxybutanoate |
| SMILES | CC(C)=C1CCC(=O)N1OC(O)C(O)C(=O)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C15H18N2O9/c1-7(2)8-3-4-9(18)16(8)25-14(23)12(21)13(22)15(24)26-17-10(19)5-6-11(17)20/h5-6,12,14,19-21,23H,3-4H2,1-2H3 |
| InChIKey | QYFWYTNWUJFJEW-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|