C10H7ClFN3O — CID 136658243
2-(chloromethyl)-4-(3-fluoro-4-pyridinyl)-1H-pyrimidin-6-one (PubChem CID 136658243) has the molecular formula C10H7ClFN3O and a molecular weight of 239.64 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(3-fluoro-4-pyridinyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(chloromethyl)-4-(3-fluoro-4-pyridinyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136658243 |
| Molecular Formula | C10H7ClFN3O |
| Molecular Weight | 239.64 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 2-(chloromethyl)-4-(3-fluoro-4-pyridinyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2ccncc2F)nc(CCl)[nH]1 |
| InChI | InChI=1S/C10H7ClFN3O/c11-4-9-14-8(3-10(16)15-9)6-1-2-13-5-7(6)12/h1-3,5H,4H2,(H,14,15,16) |
| InChIKey | XQMBYLJNNMKPFD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.64 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|