C25H33ClN2O5 — CID 136658530
2-[[5-chloro-3-[7-[(2S)-5,5-dimethyl-4-oxooxolan-2-yl]-3-methylocta-2,6-dienyl]-2,4-dihydroxy-6-methylphenyl]methylideneamino]acetamide (PubChem CID 136658530) has the molecular formula C25H33ClN2O5 and a molecular weight of 477.00 g/mol. Its IUPAC name is 2-[[5-chloro-3-[7-[(2S)-5,5-dimethyl-4-oxooxolan-2-yl]-3-methylocta-2,6-dienyl]-2,4-dihydroxy-6-methylphenyl]methylideneamino]acetamide.
| Compound Name | 2-[[5-chloro-3-[7-[(2S)-5,5-dimethyl-4-oxooxolan-2-yl]-3-methylocta-2,6-dienyl]-2,4-dihydroxy-6-methylphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 136658530 |
| Molecular Formula | C25H33ClN2O5 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-[[5-chloro-3-[7-[(2S)-5,5-dimethyl-4-oxooxolan-2-yl]-3-methylocta-2,6-dienyl]-2,4-dihydroxy-6-methylphenyl]methylideneamino]acetamide |
| SMILES | CC(=CCc1c(O)c(Cl)c(C)c(/C=N/CC(N)=O)c1O)CCC=C(C)[C@@H]1CC(=O)C(C)(C)O1 |
| InChI | InChI=1S/C25H33ClN2O5/c1-14(7-6-8-15(2)19-11-20(29)25(4,5)33-19)9-10-17-23(31)18(12-28-13-21(27)30)16(3)22(26)24(17)32/h8-9,12,19,31-32H,6-7,10-11,13H2,1-5H3,(H2,27,30)/b14-9?,15-8?,28-12+/t19-/m0/s1 |
| InChIKey | ICWWGKGALYVSQS-BWCFTZJCSA-N |
| XLogP | 4.32 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|