C21H26ClN3O3S2 — CID 136659507
3-[3-[2-[(2R)-2-[(3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]propyl]-4H-1,2,4-thiadiazol-5-one (PubChem CID 136659507) has the molecular formula C21H26ClN3O3S2 and a molecular weight of 468.04 g/mol. Its IUPAC name is 3-[3-[2-[(2R)-2-[(3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]propyl]-4H-1,2,4-thiadiazol-5-one.
| Compound Name | 3-[3-[2-[(2R)-2-[(3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]propyl]-4H-1,2,4-thiadiazol-5-one |
|---|---|
| PubChem CID | 136659507 |
| Molecular Formula | C21H26ClN3O3S2 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 3-[3-[2-[(2R)-2-[(3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]propyl]-4H-1,2,4-thiadiazol-5-one |
| SMILES | O=C1CC[C@H](C=C[C@@H](O)Cc2cccc(Cl)c2)N1CCSCCCc1nsc(=O)[nH]1 |
| InChI | InChI=1S/C21H26ClN3O3S2/c22-16-4-1-3-15(13-16)14-18(26)8-6-17-7-9-20(27)25(17)10-12-29-11-2-5-19-23-21(28)30-24-19/h1,3-4,6,8,13,17-18,26H,2,5,7,9-12,14H2,(H,23,24,28)/t17-,18+/m0/s1 |
| InChIKey | DWOJNLRIOAIFBH-ZWKOTPCHSA-N |
| XLogP | 3.30 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|