About CID 136659666
CID 136659666 (PubChem CID 136659666) has the molecular formula C37H47BN3O3
and a molecular weight of 592.61 g/mol.
Molecular Properties
| Compound Name | CID 136659666 |
| PubChem CID | 136659666 |
| Molecular Formula | C37H47BN3O3 |
| Molecular Weight | 592.61 g/mol |
| Exact Mass | 592.37 |
| IUPAC Name | — |
| SMILES | CC.C[B]C(=O)C(C)Oc1ccc(-c2nc(-c3c(C)c(C)c(C)c(C)c3C)nc(-c3c(C)c(C)c(C)c(C)c3C)n2)c(O)c1 |
| InChI | InChI=1S/C35H41BN3O3.C2H6/c1-16-18(3)22(7)30(23(8)19(16)4)34-37-33(28-14-13-27(15-29(28)40)42-26(11)32(41)36-12)38-35(39-34)31-24(9)20(5)17(2)21(6)25(31)10;1-2/h13-15,26,40H,1-12H3;1-2H3 |
| InChIKey | BOFMRZUIQZLANB-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.61 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136659666 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136659666?
The IUPAC name of CID 136659666 (CID 136659666) is not available.
What is the SMILES notation for CID 136659666?
The canonical SMILES for CID 136659666 is CC.C[B]C(=O)C(C)Oc1ccc(-c2nc(-c3c(C)c(C)c(C)c(C)c3C)nc(-c3c(C)c(C)c(C)c(C)c3C)n2)c(O)c1.
What is the InChIKey of CID 136659666?
The InChIKey is BOFMRZUIQZLANB-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H41BN3O3.C2H6/c1-16-18(3)22(7)30(23(8)19(16)4)34-37-33(28-14-13-27(15-29(28)40)42-26(11)32(41)36-12)38-35(39-34)31-24(9)20(5)17(2)21(6)25(31)10;1-2/h13-15,26,40H,1-12H3;1-2H3.
What are the key properties of CID 136659666?
CID 136659666 has a molecular weight of 592.61 g/mol, XLogP of 8.73, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136659666 is sourced from PubChem (CID 136659666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).