C17H17N3O4S — CID 136660243
(5S)-4,7-dimethyl-2-(4-methyl-2,1,3-benzothiadiazol-5-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol (PubChem CID 136660243) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is (5S)-4,7-dimethyl-2-(4-methyl-2,1,3-benzothiadiazol-5-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol.
| Compound Name | (5S)-4,7-dimethyl-2-(4-methyl-2,1,3-benzothiadiazol-5-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol |
|---|---|
| PubChem CID | 136660243 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | (5S)-4,7-dimethyl-2-(4-methyl-2,1,3-benzothiadiazol-5-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol |
| SMILES | Cc1c(-n2c(O)c3c(c2O)C2(C)OC3(C)C[C@@H]2O)ccc2nsnc12 |
| InChI | InChI=1S/C17H17N3O4S/c1-7-9(5-4-8-13(7)19-25-18-8)20-14(22)11-12(15(20)23)17(3)10(21)6-16(11,2)24-17/h4-5,10,21-23H,6H2,1-3H3/t10-,16?,17?/m0/s1 |
| InChIKey | DFZOKCLODQUUTD-DTUOUAAVSA-N |
| XLogP | 2.43 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |