C11H7ClN2O4 — CID 136660992
3-(3-chloro-4-hydroxyphenyl)-6-oxo-1H-pyridazine-5-carboxylic acid (PubChem CID 136660992) has the molecular formula C11H7ClN2O4 and a molecular weight of 266.64 g/mol. Its IUPAC name is 3-(3-chloro-4-hydroxyphenyl)-6-oxo-1H-pyridazine-5-carboxylic acid.
| Compound Name | 3-(3-chloro-4-hydroxyphenyl)-6-oxo-1H-pyridazine-5-carboxylic acid |
|---|---|
| PubChem CID | 136660992 |
| Molecular Formula | C11H7ClN2O4 |
| Molecular Weight | 266.64 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 3-(3-chloro-4-hydroxyphenyl)-6-oxo-1H-pyridazine-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(O)c(Cl)c2)n[nH]c1=O |
| InChI | InChI=1S/C11H7ClN2O4/c12-7-3-5(1-2-9(7)15)8-4-6(11(17)18)10(16)14-13-8/h1-4,15H,(H,14,16)(H,17,18) |
| InChIKey | GSSPHNSKOVZRQJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.64 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |