C26H19BF2N2O2 — CID 136661086
6-difluoroboranyloxy-2,7-dimethyl-4,5-dipyridin-2-ylphenanthren-3-ol (PubChem CID 136661086) has the molecular formula C26H19BF2N2O2 and a molecular weight of 440.26 g/mol. Its IUPAC name is 6-difluoroboranyloxy-2,7-dimethyl-4,5-dipyridin-2-ylphenanthren-3-ol.
| Compound Name | 6-difluoroboranyloxy-2,7-dimethyl-4,5-dipyridin-2-ylphenanthren-3-ol |
|---|---|
| PubChem CID | 136661086 |
| Molecular Formula | C26H19BF2N2O2 |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 6-difluoroboranyloxy-2,7-dimethyl-4,5-dipyridin-2-ylphenanthren-3-ol |
| SMILES | Cc1cc2ccc3cc(C)c(OB(F)F)c(-c4ccccn4)c3c2c(-c2ccccn2)c1O |
| InChI | InChI=1S/C26H19BF2N2O2/c1-15-13-17-9-10-18-14-16(2)26(33-27(28)29)24(20-8-4-6-12-31-20)22(18)21(17)23(25(15)32)19-7-3-5-11-30-19/h3-14,32H,1-2H3 |
| InChIKey | YLNJANPJDVCABI-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|