C23H18N4O4 — CID 136661120
4-(4-hydroxy-3,5-dimethylphenyl)-2-[(5-nitro-2-pyridinyl)diazenyl]naphthalen-1-ol (PubChem CID 136661120) has the molecular formula C23H18N4O4 and a molecular weight of 414.42 g/mol. Its IUPAC name is 4-(4-hydroxy-3,5-dimethylphenyl)-2-[(5-nitro-2-pyridinyl)diazenyl]naphthalen-1-ol.
| Compound Name | 4-(4-hydroxy-3,5-dimethylphenyl)-2-[(5-nitro-2-pyridinyl)diazenyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 136661120 |
| Molecular Formula | C23H18N4O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 4-(4-hydroxy-3,5-dimethylphenyl)-2-[(5-nitro-2-pyridinyl)diazenyl]naphthalen-1-ol |
| SMILES | Cc1cc(-c2cc(/N=N/c3ccc([N+](=O)[O-])cn3)c(O)c3ccccc23)cc(C)c1O |
| InChI | InChI=1S/C23H18N4O4/c1-13-9-15(10-14(2)22(13)28)19-11-20(23(29)18-6-4-3-5-17(18)19)25-26-21-8-7-16(12-24-21)27(30)31/h3-12,28-29H,1-2H3/b26-25+ |
| InChIKey | ATASXMFEJWGKSY-OCEACIFDSA-N |
| XLogP | 6.25 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|