C7H7N5OS — CID 136661187
[(5R)-7-hydroxy-5-methyl-4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl] thiocyanate (PubChem CID 136661187) has the molecular formula C7H7N5OS and a molecular weight of 209.23 g/mol. Its IUPAC name is [(5R)-7-hydroxy-5-methyl-4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl] thiocyanate.
| Compound Name | [(5R)-7-hydroxy-5-methyl-4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl] thiocyanate |
|---|---|
| PubChem CID | 136661187 |
| Molecular Formula | C7H7N5OS |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | [(5R)-7-hydroxy-5-methyl-4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl] thiocyanate |
| SMILES | C[C@H]1Nc2ncnn2C(O)=C1SC#N |
| InChI | InChI=1S/C7H7N5OS/c1-4-5(14-2-8)6(13)12-7(11-4)9-3-10-12/h3-4,13H,1H3,(H,9,10,11)/t4-/m1/s1 |
| InChIKey | MDCJTGHGEAFJKN-SCSAIBSYSA-N |
| XLogP | 0.99 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|