C17H17ClN2O4 — CID 136661400
2-(4-chloro-3-methylphenoxy)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 136661400) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136661400 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cccc(/C=N\NC(=O)COc2ccc(Cl)c(C)c2)c1O |
| InChI | InChI=1S/C17H17ClN2O4/c1-11-8-13(6-7-14(11)18)24-10-16(21)20-19-9-12-4-3-5-15(23-2)17(12)22/h3-9,22H,10H2,1-2H3,(H,20,21)/b19-9- |
| InChIKey | IOQXWBDXTNERCD-OCKHKDLRSA-N |
| XLogP | 2.89 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|