C16H16N2O8 — CID 136661637
5-[(E)-2-[(E)-(2,4,5-trihydroxyphenyl)methylideneamino]oxyethoxyiminomethyl]benzene-1,2,4-triol (PubChem CID 136661637) has the molecular formula C16H16N2O8 and a molecular weight of 364.31 g/mol. Its IUPAC name is 5-[(E)-2-[(E)-(2,4,5-trihydroxyphenyl)methylideneamino]oxyethoxyiminomethyl]benzene-1,2,4-triol.
| Compound Name | 5-[(E)-2-[(E)-(2,4,5-trihydroxyphenyl)methylideneamino]oxyethoxyiminomethyl]benzene-1,2,4-triol |
|---|---|
| PubChem CID | 136661637 |
| Molecular Formula | C16H16N2O8 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 5-[(E)-2-[(E)-(2,4,5-trihydroxyphenyl)methylideneamino]oxyethoxyiminomethyl]benzene-1,2,4-triol |
| SMILES | Oc1cc(O)c(/C=N/OCCO/N=C/c2cc(O)c(O)cc2O)cc1O |
| InChI | InChI=1S/C16H16N2O8/c19-11-5-15(23)13(21)3-9(11)7-17-25-1-2-26-18-8-10-4-14(22)16(24)6-12(10)20/h3-8,19-24H,1-2H2/b17-7+,18-8+ |
| InChIKey | NINSWQGHODZDGN-ZEELXFFVSA-N |
| XLogP | 1.32 |
| TPSA | 164.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|