C20H14N2O4S2 — CID 136663133
(3Z)-3-[[4-hydroxy-3-(3-hydroxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-7-methoxyquinolin-2-one (PubChem CID 136663133) has the molecular formula C20H14N2O4S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is (3Z)-3-[[4-hydroxy-3-(3-hydroxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-7-methoxyquinolin-2-one.
| Compound Name | (3Z)-3-[[4-hydroxy-3-(3-hydroxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-7-methoxyquinolin-2-one |
|---|---|
| PubChem CID | 136663133 |
| Molecular Formula | C20H14N2O4S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | (3Z)-3-[[4-hydroxy-3-(3-hydroxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]methylidene]-7-methoxyquinolin-2-one |
| SMILES | COc1ccc2c(c1)=NC(=O)/C(=C\c1sc(=S)n(-c3cccc(O)c3)c1O)C=2 |
| InChI | InChI=1S/C20H14N2O4S2/c1-26-15-6-5-11-7-12(18(24)21-16(11)10-15)8-17-19(25)22(20(27)28-17)13-3-2-4-14(23)9-13/h2-10,23,25H,1H3/b12-8- |
| InChIKey | DRSOFMRQVIFQJW-WQLSENKSSA-N |
| XLogP | 2.71 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|