C15H23N5O3 — CID 136663807
1-acetyl-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]piperidine-4-carboxamide (PubChem CID 136663807) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-acetyl-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 136663807 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 1-acetyl-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)NCCNc2nc(C)cc(=O)[nH]2)CC1 |
| InChI | InChI=1S/C15H23N5O3/c1-10-9-13(22)19-15(18-10)17-6-5-16-14(23)12-3-7-20(8-4-12)11(2)21/h9,12H,3-8H2,1-2H3,(H,16,23)(H2,17,18,19,22) |
| InChIKey | LQCLWVICFUEPQT-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|