About 4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol
4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol (PubChem CID 136664221) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol |
| PubChem CID | 136664221 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol |
| SMILES | COC1C=C(/C=C/COO)C=CC1O |
| InChI | InChI=1S/C10H14O4/c1-13-10-7-8(3-2-6-14-12)4-5-9(10)11/h2-5,7,9-12H,6H2,1H3/b3-2+ |
| InChIKey | ZANXDYYWOLDISZ-NSCUHMNNSA-N |
| XLogP | 0.90 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol?
The IUPAC name of 4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol (CID 136664221) is 4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol?
The canonical SMILES for 4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol is COC1C=C(/C=C/COO)C=CC1O.
What is the InChIKey of 4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol?
The InChIKey is ZANXDYYWOLDISZ-NSCUHMNNSA-N. The full InChI is InChI=1S/C10H14O4/c1-13-10-7-8(3-2-6-14-12)4-5-9(10)11/h2-5,7,9-12H,6H2,1H3/b3-2+.
What are the key properties of 4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol?
4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol has a molecular weight of 198.22 g/mol, XLogP of 0.90, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-3-hydroperoxyprop-1-enyl]-6-methoxycyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 136664221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).