C19H15F4N3O — CID 136664345
N-[2-[3-(4-fluorophenyl)-5-methylpyrazol-1-yl]-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 136664345) has the molecular formula C19H15F4N3O and a molecular weight of 377.34 g/mol. Its IUPAC name is N-[2-[3-(4-fluorophenyl)-5-methylpyrazol-1-yl]-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[2-[3-(4-fluorophenyl)-5-methylpyrazol-1-yl]-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 136664345 |
| Molecular Formula | C19H15F4N3O |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-[2-[3-(4-fluorophenyl)-5-methylpyrazol-1-yl]-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(F)(F)F)cc1-n1nc(-c2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C19H15F4N3O/c1-11-9-17(13-3-6-15(20)7-4-13)25-26(11)18-10-14(19(21,22)23)5-8-16(18)24-12(2)27/h3-10H,1-2H3,(H,24,27) |
| InChIKey | XUPMFBFXXRVAFG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |