C14H12F14O4S — CID 136664379
1-[2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)propylsulfanyl]propan-2-yl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 136664379) has the molecular formula C14H12F14O4S and a molecular weight of 542.29 g/mol. Its IUPAC name is 1-[2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)propylsulfanyl]propan-2-yl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | 1-[2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)propylsulfanyl]propan-2-yl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 136664379 |
| Molecular Formula | C14H12F14O4S |
| Molecular Weight | 542.29 g/mol |
| Exact Mass | 542.02 |
| IUPAC Name | 1-[2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)propylsulfanyl]propan-2-yl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CC(CSCC(C)OC(=O)C(F)(F)C(F)(F)C(F)(F)F)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F14O4S/c1-5(31-7(29)9(15,16)11(19,20)13(23,24)25)3-33-4-6(2)32-8(30)10(17,18)12(21,22)14(26,27)28/h5-6H,3-4H2,1-2H3 |
| InChIKey | DESAJVQIZYMIKV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.29 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|