C19H21N3O3 — CID 136664872
5-oxo-N-[3-(6-oxo-1H-pyrimidin-4-yl)cyclobutyl]-5-phenylpentanamide (PubChem CID 136664872) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is 5-oxo-N-[3-(6-oxo-1H-pyrimidin-4-yl)cyclobutyl]-5-phenylpentanamide.
| Compound Name | 5-oxo-N-[3-(6-oxo-1H-pyrimidin-4-yl)cyclobutyl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 136664872 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 5-oxo-N-[3-(6-oxo-1H-pyrimidin-4-yl)cyclobutyl]-5-phenylpentanamide |
| SMILES | O=C(CCCC(=O)c1ccccc1)NC1CC(c2cc(=O)[nH]cn2)C1 |
| InChI | InChI=1S/C19H21N3O3/c23-17(13-5-2-1-3-6-13)7-4-8-18(24)22-15-9-14(10-15)16-11-19(25)21-12-20-16/h1-3,5-6,11-12,14-15H,4,7-10H2,(H,22,24)(H,20,21,25) |
| InChIKey | NPSONVLDDJUVDB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |