C19H21F3N4O2 — CID 136665507
2-morpholin-4-yl-7-[(2,4,5-trifluorophenyl)methyl]-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one (PubChem CID 136665507) has the molecular formula C19H21F3N4O2 and a molecular weight of 394.40 g/mol. Its IUPAC name is 2-morpholin-4-yl-7-[(2,4,5-trifluorophenyl)methyl]-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one.
| Compound Name | 2-morpholin-4-yl-7-[(2,4,5-trifluorophenyl)methyl]-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one |
|---|---|
| PubChem CID | 136665507 |
| Molecular Formula | C19H21F3N4O2 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-morpholin-4-yl-7-[(2,4,5-trifluorophenyl)methyl]-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one |
| SMILES | O=c1[nH]c(N2CCOCC2)nc2c1CCN(Cc1cc(F)c(F)cc1F)CC2 |
| InChI | InChI=1S/C19H21F3N4O2/c20-14-10-16(22)15(21)9-12(14)11-25-3-1-13-17(2-4-25)23-19(24-18(13)27)26-5-7-28-8-6-26/h9-10H,1-8,11H2,(H,23,24,27) |
| InChIKey | FRDOQMBUGFUANP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|