C20H25F2N5O — CID 136665517
7-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one (PubChem CID 136665517) has the molecular formula C20H25F2N5O and a molecular weight of 389.45 g/mol. Its IUPAC name is 7-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one.
| Compound Name | 7-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one |
|---|---|
| PubChem CID | 136665517 |
| Molecular Formula | C20H25F2N5O |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 7-[(3,4-difluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one |
| SMILES | CN1CCN(c2nc3c(c(=O)[nH]2)CCN(Cc2ccc(F)c(F)c2)CC3)CC1 |
| InChI | InChI=1S/C20H25F2N5O/c1-25-8-10-27(11-9-25)20-23-18-5-7-26(6-4-15(18)19(28)24-20)13-14-2-3-16(21)17(22)12-14/h2-3,12H,4-11,13H2,1H3,(H,23,24,28) |
| InChIKey | UDMVQXXWMBWRRO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |