C22H23F2N5O — CID 136665546
7-[(2,4-difluorophenyl)methyl]-2-[methyl(pyridin-3-ylmethyl)amino]-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one (PubChem CID 136665546) has the molecular formula C22H23F2N5O and a molecular weight of 411.46 g/mol. Its IUPAC name is 7-[(2,4-difluorophenyl)methyl]-2-[methyl(pyridin-3-ylmethyl)amino]-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one.
| Compound Name | 7-[(2,4-difluorophenyl)methyl]-2-[methyl(pyridin-3-ylmethyl)amino]-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one |
|---|---|
| PubChem CID | 136665546 |
| Molecular Formula | C22H23F2N5O |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 7-[(2,4-difluorophenyl)methyl]-2-[methyl(pyridin-3-ylmethyl)amino]-5,6,8,9-tetrahydro-3H-pyrimido[4,5-d]azepin-4-one |
| SMILES | CN(Cc1cccnc1)c1nc2c(c(=O)[nH]1)CCN(Cc1ccc(F)cc1F)CC2 |
| InChI | InChI=1S/C22H23F2N5O/c1-28(13-15-3-2-8-25-12-15)22-26-20-7-10-29(9-6-18(20)21(30)27-22)14-16-4-5-17(23)11-19(16)24/h2-5,8,11-12H,6-7,9-10,13-14H2,1H3,(H,26,27,30) |
| InChIKey | HVUYRAIDSGACSH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |