About 3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one
3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one (PubChem CID 136665751) has the molecular formula C20H15N5O2
and a molecular weight of 357.37 g/mol. Its IUPAC name is 3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one.
Molecular Properties
| Compound Name | 3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one |
| PubChem CID | 136665751 |
| Molecular Formula | C20H15N5O2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one |
| SMILES | Cc1nc2ccccc2c(=O)n1Cc1noc(-c2cc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C20H15N5O2/c1-12-21-16-9-5-3-7-14(16)20(26)25(12)11-18-23-19(27-24-18)17-10-13-6-2-4-8-15(13)22-17/h2-10,22H,11H2,1H3 |
| InChIKey | ADCLBRGKMPYNAR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one?
The IUPAC name of 3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one (CID 136665751) is 3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one.
What is the SMILES notation for 3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one?
The canonical SMILES for 3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one is Cc1nc2ccccc2c(=O)n1Cc1noc(-c2cc3ccccc3[nH]2)n1.
What is the InChIKey of 3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one?
The InChIKey is ADCLBRGKMPYNAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N5O2/c1-12-21-16-9-5-3-7-14(16)20(26)25(12)11-18-23-19(27-24-18)17-10-13-6-2-4-8-15(13)22-17/h2-10,22H,11H2,1H3.
What are the key properties of 3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one?
3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one has a molecular weight of 357.37 g/mol, XLogP of 3.28, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-2-methylquinazolin-4-one is sourced from PubChem (CID 136665751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).