C14H22ClN3O2 — CID 136666054
2-ethoxy-6-[(4-methylpiperazin-1-yl)iminomethyl]phenol;hydrochloride (PubChem CID 136666054) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is 2-ethoxy-6-[(4-methylpiperazin-1-yl)iminomethyl]phenol;hydrochloride.
| Compound Name | 2-ethoxy-6-[(4-methylpiperazin-1-yl)iminomethyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 136666054 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-ethoxy-6-[(4-methylpiperazin-1-yl)iminomethyl]phenol;hydrochloride |
| SMILES | CCOc1cccc(C=NN2CCN(C)CC2)c1O.Cl |
| InChI | InChI=1S/C14H21N3O2.ClH/c1-3-19-13-6-4-5-12(14(13)18)11-15-17-9-7-16(2)8-10-17;/h4-6,11,18H,3,7-10H2,1-2H3;1H |
| InChIKey | BUUGTLLCNUBVLH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 48.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|