C18H17N3O4 — CID 136666218
9-[(3-methoxyphenyl)diazenyl]-2,3,4,7-tetrahydro-[1,4]dioxepino[2,3-f]indol-8-ol (PubChem CID 136666218) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 9-[(3-methoxyphenyl)diazenyl]-2,3,4,7-tetrahydro-[1,4]dioxepino[2,3-f]indol-8-ol.
| Compound Name | 9-[(3-methoxyphenyl)diazenyl]-2,3,4,7-tetrahydro-[1,4]dioxepino[2,3-f]indol-8-ol |
|---|---|
| PubChem CID | 136666218 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 9-[(3-methoxyphenyl)diazenyl]-2,3,4,7-tetrahydro-[1,4]dioxepino[2,3-f]indol-8-ol |
| SMILES | COc1cccc(/N=N/c2c(O)[nH]c3cc4c(cc23)OCCCO4)c1 |
| InChI | InChI=1S/C18H17N3O4/c1-23-12-5-2-4-11(8-12)20-21-17-13-9-15-16(25-7-3-6-24-15)10-14(13)19-18(17)22/h2,4-5,8-10,19,22H,3,6-7H2,1H3/b21-20+ |
| InChIKey | QYOOJDKZTKTOJF-QZQOTICOSA-N |
| XLogP | 4.46 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|